C15H25ClO2Si — CID 139965190
(3-tert-butyl-2,5-dimethoxyphenyl)methyl-chloro-dimethylsilane (PubChem CID 139965190) has the molecular formula C15H25ClO2Si and a molecular weight of 300.90 g/mol. Its IUPAC name is (3-tert-butyl-2,5-dimethoxyphenyl)methyl-chloro-dimethylsilane.
| Compound Name | (3-tert-butyl-2,5-dimethoxyphenyl)methyl-chloro-dimethylsilane |
|---|---|
| PubChem CID | 139965190 |
| Molecular Formula | C15H25ClO2Si |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (3-tert-butyl-2,5-dimethoxyphenyl)methyl-chloro-dimethylsilane |
| SMILES | COc1cc(C[Si](C)(C)Cl)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25ClO2Si/c1-15(2,3)13-9-12(17-4)8-11(14(13)18-5)10-19(6,7)16/h8-9H,10H2,1-7H3 |
| InChIKey | FSMCBXHNRSIOKM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|