C15H23NO4 — CID 117451563
2-amino-3-(3-tert-butyl-2,5-dimethoxyphenyl)propanoic acid (PubChem CID 117451563) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-amino-3-(3-tert-butyl-2,5-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-tert-butyl-2,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117451563 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-amino-3-(3-tert-butyl-2,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(CC(N)C(=O)O)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)11-8-10(19-4)6-9(13(11)20-5)7-12(16)14(17)18/h6,8,12H,7,16H2,1-5H3,(H,17,18) |
| InChIKey | RIXIATZKDUMRAG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |