C11H14Cl2O — CID 121288639
1-tert-butyl-2,3-dichloro-5-methoxybenzene (PubChem CID 121288639) has the molecular formula C11H14Cl2O and a molecular weight of 233.14 g/mol. Its IUPAC name is 1-tert-butyl-2,3-dichloro-5-methoxybenzene.
| Compound Name | 1-tert-butyl-2,3-dichloro-5-methoxybenzene |
|---|---|
| PubChem CID | 121288639 |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1-tert-butyl-2,3-dichloro-5-methoxybenzene |
| SMILES | COc1cc(Cl)c(Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C11H14Cl2O/c1-11(2,3)8-5-7(14-4)6-9(12)10(8)13/h5-6H,1-4H3 |
| InChIKey | JAFQAUFHNPRAQU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |