About 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride
2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride (PubChem CID 157336845) has the molecular formula C12H19FO
and a molecular weight of 198.28 g/mol. Its IUPAC name is 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride.
Molecular Properties
| Compound Name | 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride |
| PubChem CID | 157336845 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride |
| SMILES | COc1ccc(C)c(C(C)(C)C)c1.F |
| InChI | InChI=1S/C12H18O.FH/c1-9-6-7-10(13-5)8-11(9)12(2,3)4;/h6-8H,1-5H3;1H |
| InChIKey | BFXXEWWQENEHCD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride?
The IUPAC name of 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride (CID 157336845) is 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride.
What is the SMILES notation for 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride?
The canonical SMILES for 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride is COc1ccc(C)c(C(C)(C)C)c1.F.
What is the InChIKey of 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride?
The InChIKey is BFXXEWWQENEHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.FH/c1-9-6-7-10(13-5)8-11(9)12(2,3)4;/h6-8H,1-5H3;1H.
What are the key properties of 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride?
2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride has a molecular weight of 198.28 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-methoxy-1-methylbenzene;hydrofluoride is sourced from PubChem (CID 157336845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).