C29H49AlO8P2 — CID 173022939
alumane;[2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-phosphonooxyphenyl)methyl]phenyl] dihydrogen phosphate (PubChem CID 173022939) has the molecular formula C29H49AlO8P2 and a molecular weight of 614.63 g/mol. Its IUPAC name is alumane;[2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-phosphonooxyphenyl)methyl]phenyl] dihydrogen phosphate.
| Compound Name | alumane;[2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-phosphonooxyphenyl)methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173022939 |
| Molecular Formula | C29H49AlO8P2 |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | alumane;[2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-phosphonooxyphenyl)methyl]phenyl] dihydrogen phosphate |
| SMILES | CC(C)(C)c1cc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(=O)(O)O)c(OP(=O)(O)O)c(C(C)(C)C)c1.[AlH3] |
| InChI | InChI=1S/C29H46O8P2.Al.3H/c1-26(2,3)20-14-18(24(36-38(30,31)32)22(16-20)28(7,8)9)13-19-15-21(27(4,5)6)17-23(29(10,11)12)25(19)37-39(33,34)35;;;;/h14-17H,13H2,1-12H3,(H2,30,31,32)(H2,33,34,35);;;; |
| InChIKey | OJRWJCQVMRWKKG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|