C21H27Cl2O5P — CID 23466418
[2-tert-butyl-6-[(3-tert-butyl-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenyl] dihydrogen phosphate (PubChem CID 23466418) has the molecular formula C21H27Cl2O5P and a molecular weight of 461.32 g/mol. Its IUPAC name is [2-tert-butyl-6-[(3-tert-butyl-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenyl] dihydrogen phosphate.
| Compound Name | [2-tert-butyl-6-[(3-tert-butyl-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23466418 |
| Molecular Formula | C21H27Cl2O5P |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [2-tert-butyl-6-[(3-tert-butyl-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenyl] dihydrogen phosphate |
| SMILES | CC(C)(C)c1cc(Cl)cc(Cc2cc(Cl)cc(C(C)(C)C)c2OP(=O)(O)O)c1O |
| InChI | InChI=1S/C21H27Cl2O5P/c1-20(2,3)16-10-14(22)8-12(18(16)24)7-13-9-15(23)11-17(21(4,5)6)19(13)28-29(25,26)27/h8-11,24H,7H2,1-6H3,(H2,25,26,27) |
| InChIKey | GATQMABVKFLJDO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|