C11H18O9P2 — CID 88734719
(3-tert-butyl-2,5-dihydroxy-6-methylphenyl) phosphono hydrogen phosphate (PubChem CID 88734719) has the molecular formula C11H18O9P2 and a molecular weight of 356.20 g/mol. Its IUPAC name is (3-tert-butyl-2,5-dihydroxy-6-methylphenyl) phosphono hydrogen phosphate.
| Compound Name | (3-tert-butyl-2,5-dihydroxy-6-methylphenyl) phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88734719 |
| Molecular Formula | C11H18O9P2 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (3-tert-butyl-2,5-dihydroxy-6-methylphenyl) phosphono hydrogen phosphate |
| SMILES | Cc1c(O)cc(C(C)(C)C)c(O)c1OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H18O9P2/c1-6-8(12)5-7(11(2,3)4)9(13)10(6)19-22(17,18)20-21(14,15)16/h5,12-13H,1-4H3,(H,17,18)(H2,14,15,16) |
| InChIKey | OOLJGIAWSVJPJZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|