C27H38O2 — CID 22974767
2-[(2-but-1-en-2-yloxy-3-tert-butyl-5-methylphenyl)methyl]-6-tert-butyl-4-methylphenol (PubChem CID 22974767) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[(2-but-1-en-2-yloxy-3-tert-butyl-5-methylphenyl)methyl]-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[(2-but-1-en-2-yloxy-3-tert-butyl-5-methylphenyl)methyl]-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 22974767 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 2-[(2-but-1-en-2-yloxy-3-tert-butyl-5-methylphenyl)methyl]-6-tert-butyl-4-methylphenol |
| SMILES | C=C(CC)Oc1c(Cc2cc(C)cc(C(C)(C)C)c2O)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H38O2/c1-11-19(4)29-25-21(13-18(3)15-23(25)27(8,9)10)16-20-12-17(2)14-22(24(20)28)26(5,6)7/h12-15,28H,4,11,16H2,1-3,5-10H3 |
| InChIKey | NCXYGJSAASKAJB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|