C69H90O7 — CID 175213832
bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;4-butyl-2-tert-butyl-5-methylphenol (PubChem CID 175213832) has the molecular formula C69H90O7 and a molecular weight of 1031.47 g/mol. Its IUPAC name is bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;4-butyl-2-tert-butyl-5-methylphenol.
| Compound Name | bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;4-butyl-2-tert-butyl-5-methylphenol |
|---|---|
| PubChem CID | 175213832 |
| Molecular Formula | C69H90O7 |
| Molecular Weight | 1031.47 g/mol |
| Exact Mass | 1030.67 |
| IUPAC Name | bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;4-butyl-2-tert-butyl-5-methylphenol |
| SMILES | CCCCc1cc(C(C)(C)C)c(O)cc1C.Cc1cc(Cc2cc(C)cc(C(C)(C)C)c2OC(=O)c2ccc(C(=O)Oc3c(Cc4cc(C)cc(C(C)(C)C)c4O)cc(C)cc3C(C)(C)C)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H66O6.C15H24O/c1-31-21-37(45(55)41(25-31)51(5,6)7)29-39-23-33(3)27-43(53(11,12)13)47(39)59-49(57)35-17-19-36(20-18-35)50(58)60-48-40(24-34(4)28-44(48)54(14,15)16)30-38-22-32(2)26-42(46(38)56)52(8,9)10;1-6-7-8-12-10-13(15(3,4)5)14(16)9-11(12)2/h17-28,55-56H,29-30H2,1-16H3;9-10,16H,6-8H2,1-5H3 |
| InChIKey | USVIMSSVGPHYBJ-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.47 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|