C68H86O9 — CID 159225823
bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;(3-tert-butyl-4-hydroxyphenyl) butanoate (PubChem CID 159225823) has the molecular formula C68H86O9 and a molecular weight of 1047.43 g/mol. Its IUPAC name is bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;(3-tert-butyl-4-hydroxyphenyl) butanoate.
| Compound Name | bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;(3-tert-butyl-4-hydroxyphenyl) butanoate |
|---|---|
| PubChem CID | 159225823 |
| Molecular Formula | C68H86O9 |
| Molecular Weight | 1047.43 g/mol |
| Exact Mass | 1046.63 |
| IUPAC Name | bis[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] benzene-1,4-dicarboxylate;(3-tert-butyl-4-hydroxyphenyl) butanoate |
| SMILES | CCCC(=O)Oc1ccc(O)c(C(C)(C)C)c1.Cc1cc(Cc2cc(C)cc(C(C)(C)C)c2OC(=O)c2ccc(C(=O)Oc3c(Cc4cc(C)cc(C(C)(C)C)c4O)cc(C)cc3C(C)(C)C)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H66O6.C14H20O3/c1-31-21-37(45(55)41(25-31)51(5,6)7)29-39-23-33(3)27-43(53(11,12)13)47(39)59-49(57)35-17-19-36(20-18-35)50(58)60-48-40(24-34(4)28-44(48)54(14,15)16)30-38-22-32(2)26-42(46(38)56)52(8,9)10;1-5-6-13(16)17-10-7-8-12(15)11(9-10)14(2,3)4/h17-28,55-56H,29-30H2,1-16H3;7-9,15H,5-6H2,1-4H3 |
| InChIKey | KSGSWMTXBQXYEC-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.43 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|