C18H29NO2 — CID 14950011
(2,4,6-tritert-butylphenyl) nitrite (PubChem CID 14950011) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl) nitrite.
| Compound Name | (2,4,6-tritert-butylphenyl) nitrite |
|---|---|
| PubChem CID | 14950011 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2,4,6-tritert-butylphenyl) nitrite |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(ON=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2/c1-16(2,3)12-10-13(17(4,5)6)15(21-19-20)14(11-12)18(7,8)9/h10-11H,1-9H3 |
| InChIKey | UTHPMNIPADNXCS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|