C11H14N2O3 — CID 89021339
5-tert-butyl-2-methoxy-1,3-dinitrosobenzene (PubChem CID 89021339) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-1,3-dinitrosobenzene.
| Compound Name | 5-tert-butyl-2-methoxy-1,3-dinitrosobenzene |
|---|---|
| PubChem CID | 89021339 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 5-tert-butyl-2-methoxy-1,3-dinitrosobenzene |
| SMILES | COc1c(N=O)cc(C(C)(C)C)cc1N=O |
| InChI | InChI=1S/C11H14N2O3/c1-11(2,3)7-5-8(12-14)10(16-4)9(6-7)13-15/h5-6H,1-4H3 |
| InChIKey | YCVBVFQHVZILHQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |