C14H28N2OS — CID 145338891
5-tert-butyl-2-methoxybenzene-1,3-diamine;ethane;methanethiol (PubChem CID 145338891) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxybenzene-1,3-diamine;ethane;methanethiol.
| Compound Name | 5-tert-butyl-2-methoxybenzene-1,3-diamine;ethane;methanethiol |
|---|---|
| PubChem CID | 145338891 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 5-tert-butyl-2-methoxybenzene-1,3-diamine;ethane;methanethiol |
| SMILES | CC.COc1c(N)cc(C(C)(C)C)cc1N.CS |
| InChI | InChI=1S/C11H18N2O.C2H6.CH4S/c1-11(2,3)7-5-8(12)10(14-4)9(13)6-7;2*1-2/h5-6H,12-13H2,1-4H3;1-2H3;2H,1H3 |
| InChIKey | ULHSQEIRIIHTBX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|