C18H28O2 — CID 613069
[4-tert-butyl-2,6-di(propan-2-yl)phenyl] acetate (PubChem CID 613069) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [4-tert-butyl-2,6-di(propan-2-yl)phenyl] acetate.
| Compound Name | [4-tert-butyl-2,6-di(propan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 613069 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [4-tert-butyl-2,6-di(propan-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)C)cc(C(C)(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H28O2/c1-11(2)15-9-14(18(6,7)8)10-16(12(3)4)17(15)20-13(5)19/h9-12H,1-8H3 |
| InChIKey | QTOGSSNEDLLOHI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|