C46H58O5 — CID 139138704
(5,11,17,23-tetratert-butyl-26,27,28-trihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl) acetate (PubChem CID 139138704) has the molecular formula C46H58O5 and a molecular weight of 690.96 g/mol. Its IUPAC name is (5,11,17,23-tetratert-butyl-26,27,28-trihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl) acetate.
| Compound Name | (5,11,17,23-tetratert-butyl-26,27,28-trihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl) acetate |
|---|---|
| PubChem CID | 139138704 |
| Molecular Formula | C46H58O5 |
| Molecular Weight | 690.96 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | (5,11,17,23-tetratert-butyl-26,27,28-trihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl) acetate |
| SMILES | CC(=O)Oc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C46H58O5/c1-26(47)51-42-33-16-31-22-36(44(5,6)7)20-29(40(31)49)14-27-18-35(43(2,3)4)19-28(39(27)48)15-30-21-37(45(8,9)10)23-32(41(30)50)17-34(42)25-38(24-33)46(11,12)13/h18-25,48-50H,14-17H2,1-13H3 |
| InChIKey | LGEMHUNXRAEPML-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.96 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|