C26H28O2 — CID 101088092
[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate (PubChem CID 101088092) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate.
| Compound Name | [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate |
|---|---|
| PubChem CID | 101088092 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate |
| SMILES | CC(=O)Oc1c(-c2ccccc2C(C)C)cccc1-c1ccccc1C(C)C |
| InChI | InChI=1S/C26H28O2/c1-17(2)20-11-6-8-13-22(20)24-15-10-16-25(26(24)28-19(5)27)23-14-9-7-12-21(23)18(3)4/h6-18H,1-5H3 |
| InChIKey | XBKDLMLDHJUFBA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|