[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate

C26H28O2 — CID 101088092

IUPAC[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate
SMILESCC(=O)Oc1c(-c2ccccc2C(C)C)cccc1-c1ccccc1C(C)C
InChIInChI=1S/C26H28O2/c1-17(2)20-11-6-8-13-22(20)24-15-10-16-25(26(24)28-19(5)27)23-14-9-7-12-21(23)18(3)4/h6-18H,1-5H3
InChIKeyXBKDLMLDHJUFBA-UHFFFAOYSA-N
MW372.51 g/mol
LogP7.19
Rot. Bonds5

About [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate

[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate (PubChem CID 101088092) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate.

Molecular Properties

Compound Name[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate
PubChem CID101088092
Molecular FormulaC26H28O2
Molecular Weight372.51 g/mol
Exact Mass372.21
IUPAC Name[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate
SMILESCC(=O)Oc1c(-c2ccccc2C(C)C)cccc1-c1ccccc1C(C)C
InChIInChI=1S/C26H28O2/c1-17(2)20-11-6-8-13-22(20)24-15-10-16-25(26(24)28-19(5)27)23-14-9-7-12-21(23)18(3)4/h6-18H,1-5H3
InChIKeyXBKDLMLDHJUFBA-UHFFFAOYSA-N
XLogP7.19
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500372.51
LogP ≤ 57.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate?
The IUPAC name of [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate (CID 101088092) is [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate.
What is the SMILES notation for [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate?
The canonical SMILES for [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate is CC(=O)Oc1c(-c2ccccc2C(C)C)cccc1-c1ccccc1C(C)C.
What is the InChIKey of [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate?
The InChIKey is XBKDLMLDHJUFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28O2/c1-17(2)20-11-6-8-13-22(20)24-15-10-16-25(26(24)28-19(5)27)23-14-9-7-12-21(23)18(3)4/h6-18H,1-5H3.
What are the key properties of [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate?
[2,6-bis(2-propan-2-ylphenyl)phenyl] acetate has a molecular weight of 372.51 g/mol, XLogP of 7.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(2-propan-2-ylphenyl)phenyl] acetate is sourced from PubChem (CID 101088092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).