C14H20O5S — CID 57208791
[2,6-di(propan-2-yl)phenoxy]sulfonyl acetate (PubChem CID 57208791) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenoxy]sulfonyl acetate.
| Compound Name | [2,6-di(propan-2-yl)phenoxy]sulfonyl acetate |
|---|---|
| PubChem CID | 57208791 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [2,6-di(propan-2-yl)phenoxy]sulfonyl acetate |
| SMILES | CC(=O)OS(=O)(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C14H20O5S/c1-9(2)12-7-6-8-13(10(3)4)14(12)19-20(16,17)18-11(5)15/h6-10H,1-5H3 |
| InChIKey | LEGKPGODBKOFST-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |