C19H22FNO5S — CID 10834516
(4-fluorophenyl) N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate (PubChem CID 10834516) has the molecular formula C19H22FNO5S and a molecular weight of 395.45 g/mol. Its IUPAC name is (4-fluorophenyl) N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate.
| Compound Name | (4-fluorophenyl) N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate |
|---|---|
| PubChem CID | 10834516 |
| Molecular Formula | C19H22FNO5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (4-fluorophenyl) N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate |
| SMILES | CC(C)c1cccc(C(C)C)c1OS(=O)(=O)NC(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO5S/c1-12(2)16-6-5-7-17(13(3)4)18(16)26-27(23,24)21-19(22)25-15-10-8-14(20)9-11-15/h5-13H,1-4H3,(H,21,22) |
| InChIKey | YJHGYHOHAKYKKR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |