C16H24FNO2 — CID 171732925
(4-fluorophenyl) N-(2,2,4,4-tetramethylpentan-3-yl)carbamate (PubChem CID 171732925) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is (4-fluorophenyl) N-(2,2,4,4-tetramethylpentan-3-yl)carbamate.
| Compound Name | (4-fluorophenyl) N-(2,2,4,4-tetramethylpentan-3-yl)carbamate |
|---|---|
| PubChem CID | 171732925 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (4-fluorophenyl) N-(2,2,4,4-tetramethylpentan-3-yl)carbamate |
| SMILES | CC(C)(C)C(NC(=O)Oc1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H24FNO2/c1-15(2,3)13(16(4,5)6)18-14(19)20-12-9-7-11(17)8-10-12/h7-10,13H,1-6H3,(H,18,19) |
| InChIKey | AZOIOYPSONMQST-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |