C14H18FNO3 — CID 103926387
(2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 103926387) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103926387 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-2-[[2-(4-fluorophenyl)acetyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C14H18FNO3/c1-14(2,3)12(13(18)19)16-11(17)8-9-4-6-10(15)7-5-9/h4-7,12H,8H2,1-3H3,(H,16,17)(H,18,19)/t12-/m0/s1 |
| InChIKey | LYQDJEOPMFZLPF-LBPRGKRZSA-N |
| XLogP | 1.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |