C17H25NO3 — CID 61144373
(2S)-2-[3-(4-ethylphenyl)propanoylamino]-3,3-dimethylbutanoic acid (PubChem CID 61144373) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S)-2-[3-(4-ethylphenyl)propanoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[3-(4-ethylphenyl)propanoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61144373 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2S)-2-[3-(4-ethylphenyl)propanoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CCc1ccc(CCC(=O)N[C@H](C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-5-12-6-8-13(9-7-12)10-11-14(19)18-15(16(20)21)17(2,3)4/h6-9,15H,5,10-11H2,1-4H3,(H,18,19)(H,20,21)/t15-/m1/s1 |
| InChIKey | UVBAKLJEUOGIHE-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |