C25H33NO4S — CID 10297231
[2,6-di(propan-2-yl)phenyl] N-(2-cyclopentyl-2-phenylacetyl)sulfamate (PubChem CID 10297231) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-(2-cyclopentyl-2-phenylacetyl)sulfamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-(2-cyclopentyl-2-phenylacetyl)sulfamate |
|---|---|
| PubChem CID | 10297231 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-(2-cyclopentyl-2-phenylacetyl)sulfamate |
| SMILES | CC(C)c1cccc(C(C)C)c1OS(=O)(=O)NC(=O)C(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C25H33NO4S/c1-17(2)21-15-10-16-22(18(3)4)24(21)30-31(28,29)26-25(27)23(20-13-8-9-14-20)19-11-6-5-7-12-19/h5-7,10-12,15-18,20,23H,8-9,13-14H2,1-4H3,(H,26,27) |
| InChIKey | FOZRJHUQQPEXOV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |