C16H20N2O — CID 125465712
(2R)-N-(cyanomethyl)-2-cyclohexyl-2-phenylacetamide (PubChem CID 125465712) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (2R)-N-(cyanomethyl)-2-cyclohexyl-2-phenylacetamide.
| Compound Name | (2R)-N-(cyanomethyl)-2-cyclohexyl-2-phenylacetamide |
|---|---|
| PubChem CID | 125465712 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2R)-N-(cyanomethyl)-2-cyclohexyl-2-phenylacetamide |
| SMILES | N#CCNC(=O)[C@@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H20N2O/c17-11-12-18-16(19)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-4,7-8,14-15H,2,5-6,9-10,12H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | KOBSENHVVIUBFO-HNNXBMFYSA-N |
| XLogP | 2.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|