C18H22BrN3O2 — CID 87849379
2-bromo-N-[3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]benzamide (PubChem CID 87849379) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-bromo-N-[3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]benzamide.
| Compound Name | 2-bromo-N-[3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 87849379 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-bromo-N-[3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]benzamide |
| SMILES | N#CCNC(=O)C(CNC(=O)c1ccccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C18H22BrN3O2/c19-16-9-5-4-8-14(16)17(23)22-12-15(18(24)21-11-10-20)13-6-2-1-3-7-13/h4-5,8-9,13,15H,1-3,6-7,11-12H2,(H,21,24)(H,22,23) |
| InChIKey | GHIPFNSUDYYHJL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|