C12H19N3O3 — CID 57318228
[3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]carbamic acid (PubChem CID 57318228) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is [3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]carbamic acid.
| Compound Name | [3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 57318228 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [3-(cyanomethylamino)-2-cyclohexyl-3-oxopropyl]carbamic acid |
| SMILES | N#CCNC(=O)C(CNC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C12H19N3O3/c13-6-7-14-11(16)10(8-15-12(17)18)9-4-2-1-3-5-9/h9-10,15H,1-5,7-8H2,(H,14,16)(H,17,18) |
| InChIKey | JUGIZJHVEQOCJW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|