C16H29N3O4 — CID 69181719
[(2R)-2-cyclohexyl-3-[(3-hydroxyazepan-4-yl)amino]-3-oxopropyl]carbamic acid (PubChem CID 69181719) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is [(2R)-2-cyclohexyl-3-[(3-hydroxyazepan-4-yl)amino]-3-oxopropyl]carbamic acid.
| Compound Name | [(2R)-2-cyclohexyl-3-[(3-hydroxyazepan-4-yl)amino]-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 69181719 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | [(2R)-2-cyclohexyl-3-[(3-hydroxyazepan-4-yl)amino]-3-oxopropyl]carbamic acid |
| SMILES | O=C(O)NC[C@H](C(=O)NC1CCCNCC1O)C1CCCCC1 |
| InChI | InChI=1S/C16H29N3O4/c20-14-10-17-8-4-7-13(14)19-15(21)12(9-18-16(22)23)11-5-2-1-3-6-11/h11-14,17-18,20H,1-10H2,(H,19,21)(H,22,23)/t12-,13?,14?/m0/s1 |
| InChIKey | RYTOQJKWWYRKKM-HSBZDZAISA-N |
| XLogP | 0.68 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |