C10H18N2O4 — CID 107222087
3-amino-4-[[(1R,2R)-2-hydroxycyclohexyl]amino]-4-oxobutanoic acid (PubChem CID 107222087) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-amino-4-[[(1R,2R)-2-hydroxycyclohexyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[(1R,2R)-2-hydroxycyclohexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107222087 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-amino-4-[[(1R,2R)-2-hydroxycyclohexyl]amino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H18N2O4/c11-6(5-9(14)15)10(16)12-7-3-1-2-4-8(7)13/h6-8,13H,1-5,11H2,(H,12,16)(H,14,15)/t6?,7-,8-/m1/s1 |
| InChIKey | FWCCCSJLRXCPBP-SPDVFEMOSA-N |
| XLogP | -0.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |