C15H22N2O2 — CID 107221661
(2R)-2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-3-phenylpropanamide (PubChem CID 107221661) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R)-2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 107221661 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2R)-2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-3-phenylpropanamide |
| SMILES | N[C@H](Cc1ccccc1)C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C15H22N2O2/c16-12(10-11-6-2-1-3-7-11)15(19)17-13-8-4-5-9-14(13)18/h1-3,6-7,12-14,18H,4-5,8-10,16H2,(H,17,19)/t12-,13+,14+/m1/s1 |
| InChIKey | SQFUVMHTLQBVGO-RDBSUJKOSA-N |
| XLogP | 0.98 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |