C10H19N3O3 — CID 107221602
2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]butanediamide (PubChem CID 107221602) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]butanediamide.
| Compound Name | 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]butanediamide |
|---|---|
| PubChem CID | 107221602 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H19N3O3/c11-6(5-9(12)15)10(16)13-7-3-1-2-4-8(7)14/h6-8,14H,1-5,11H2,(H2,12,15)(H,13,16)/t6?,7-,8-/m0/s1 |
| InChIKey | ZUJXRQVGNAMKKK-ALKRTJFJSA-N |
| XLogP | -1.39 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |