C11H20ClN3O2 — CID 119957470
2-amino-N-(2-bicyclo[2.2.1]heptanyl)butanediamide;hydrochloride (PubChem CID 119957470) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-amino-N-(2-bicyclo[2.2.1]heptanyl)butanediamide;hydrochloride.
| Compound Name | 2-amino-N-(2-bicyclo[2.2.1]heptanyl)butanediamide;hydrochloride |
|---|---|
| PubChem CID | 119957470 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-amino-N-(2-bicyclo[2.2.1]heptanyl)butanediamide;hydrochloride |
| SMILES | Cl.NC(=O)CC(N)C(=O)NC1CC2CCC1C2 |
| InChI | InChI=1S/C11H19N3O2.ClH/c12-8(5-10(13)15)11(16)14-9-4-6-1-2-7(9)3-6;/h6-9H,1-5,12H2,(H2,13,15)(H,14,16);1H |
| InChIKey | QPIAFNIIRBVMTO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |