About 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide
3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide (PubChem CID 142647883) has the molecular formula C17H30N2O2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide.
Molecular Properties
| Compound Name | 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide |
| PubChem CID | 142647883 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide |
| SMILES | NC(CC1CCCCC1)C(O)C(=O)NC1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C17H30N2O2/c18-14(9-11-4-2-1-3-5-11)16(20)17(21)19-15-10-12-6-7-13(15)8-12/h11-16,20H,1-10,18H2,(H,19,21)/t12-,13+,14?,15?,16?/m0/s1 |
| InChIKey | VHQMURPHXCVISG-DKYXIQLCSA-N |
| XLogP | 1.95 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide?
The IUPAC name of 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide (CID 142647883) is 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide.
What is the SMILES notation for 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide?
The canonical SMILES for 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide is NC(CC1CCCCC1)C(O)C(=O)NC1C[C@H]2CC[C@@H]1C2.
What is the InChIKey of 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide?
The InChIKey is VHQMURPHXCVISG-DKYXIQLCSA-N. The full InChI is InChI=1S/C17H30N2O2/c18-14(9-11-4-2-1-3-5-11)16(20)17(21)19-15-10-12-6-7-13(15)8-12/h11-16,20H,1-10,18H2,(H,19,21)/t12-,13+,14?,15?,16?/m0/s1.
What are the key properties of 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide?
3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide has a molecular weight of 294.44 g/mol, XLogP of 1.95, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide is sourced from PubChem (CID 142647883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).