C16H29N3O4 — CID 141016943
4-[(3-amino-4-cyclohexyl-2-hydroxybutanoyl)amino]piperidine-1-carboxylic acid (PubChem CID 141016943) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[(3-amino-4-cyclohexyl-2-hydroxybutanoyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(3-amino-4-cyclohexyl-2-hydroxybutanoyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141016943 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 4-[(3-amino-4-cyclohexyl-2-hydroxybutanoyl)amino]piperidine-1-carboxylic acid |
| SMILES | NC(CC1CCCCC1)C(O)C(=O)NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C16H29N3O4/c17-13(10-11-4-2-1-3-5-11)14(20)15(21)18-12-6-8-19(9-7-12)16(22)23/h11-14,20H,1-10,17H2,(H,18,21)(H,22,23) |
| InChIKey | AFOZQIGCNHVQEX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |