C16H30N2O4 — CID 70097268
ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]butanoate (PubChem CID 70097268) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]butanoate.
| Compound Name | ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 70097268 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C16H30N2O4/c1-3-22-14(19)9-11(2)18-16(21)15(20)13(17)10-12-7-5-4-6-8-12/h11-13,15,20H,3-10,17H2,1-2H3,(H,18,21)/t11?,13-,15?/m1/s1 |
| InChIKey | PSWVZSPWDAVUQF-GLWUULTISA-N |
| XLogP | 1.10 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |