C15H29ClN2O4 — CID 70063212
ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride (PubChem CID 70063212) has the molecular formula C15H29ClN2O4 and a molecular weight of 336.86 g/mol. Its IUPAC name is ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 70063212 |
| Molecular Formula | C15H29ClN2O4 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl 3-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCNC(=O)C(O)[C@H](N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C15H28N2O4.ClH/c1-2-21-13(18)8-9-17-15(20)14(19)12(16)10-11-6-4-3-5-7-11;/h11-12,14,19H,2-10,16H2,1H3,(H,17,20);1H/t12-,14?;/m1./s1 |
| InChIKey | YAIMIRBZTZSWEY-UYUUDJTFSA-N |
| XLogP | 1.14 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |