C11H23ClN2O4S — CID 142647874
ethyl 3-[(3-amino-2-hydroxy-5-methylsulfanylpentanoyl)amino]propanoate;hydrochloride (PubChem CID 142647874) has the molecular formula C11H23ClN2O4S and a molecular weight of 314.84 g/mol. Its IUPAC name is ethyl 3-[(3-amino-2-hydroxy-5-methylsulfanylpentanoyl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[(3-amino-2-hydroxy-5-methylsulfanylpentanoyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 142647874 |
| Molecular Formula | C11H23ClN2O4S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | ethyl 3-[(3-amino-2-hydroxy-5-methylsulfanylpentanoyl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCNC(=O)C(O)C(N)CCSC.Cl |
| InChI | InChI=1S/C11H22N2O4S.ClH/c1-3-17-9(14)4-6-13-11(16)10(15)8(12)5-7-18-2;/h8,10,15H,3-7,12H2,1-2H3,(H,13,16);1H |
| InChIKey | GCUBFZIGKGURDD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |