C17H35ClN2O3 — CID 70064203
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[3-(2-methylpropoxy)propyl]butanamide;hydrochloride (PubChem CID 70064203) has the molecular formula C17H35ClN2O3 and a molecular weight of 350.93 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[3-(2-methylpropoxy)propyl]butanamide;hydrochloride.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[3-(2-methylpropoxy)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 70064203 |
| Molecular Formula | C17H35ClN2O3 |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[3-(2-methylpropoxy)propyl]butanamide;hydrochloride |
| SMILES | CC(C)COCCCNC(=O)C(O)[C@H](N)CC1CCCCC1.Cl |
| InChI | InChI=1S/C17H34N2O3.ClH/c1-13(2)12-22-10-6-9-19-17(21)16(20)15(18)11-14-7-4-3-5-8-14;/h13-16,20H,3-12,18H2,1-2H3,(H,19,21);1H/t15-,16?;/m1./s1 |
| InChIKey | PYTAJXXXANOHKX-PGZQCDFOSA-N |
| XLogP | 2.25 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|