C7H13ClN2O2 — CID 171058651
3-amino-N-chloro-4-cyclopropyl-2-hydroxybutanamide (PubChem CID 171058651) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 3-amino-N-chloro-4-cyclopropyl-2-hydroxybutanamide.
| Compound Name | 3-amino-N-chloro-4-cyclopropyl-2-hydroxybutanamide |
|---|---|
| PubChem CID | 171058651 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-amino-N-chloro-4-cyclopropyl-2-hydroxybutanamide |
| SMILES | NC(CC1CC1)C(O)C(=O)NCl |
| InChI | InChI=1S/C7H13ClN2O2/c8-10-7(12)6(11)5(9)3-4-1-2-4/h4-6,11H,1-3,9H2,(H,10,12) |
| InChIKey | KBAJODOQBQEIBM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|