C8H14N2O — CID 98511353
[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 98511353) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 98511353 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | NC(=O)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H14N2O/c9-8(11)10-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H3,9,10,11)/t5-,6-,7-/m0/s1 |
| InChIKey | XUFVQYYHZUXUKV-ACZMJKKPSA-N |
| XLogP | 0.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |