C30H45N3O3 — CID 171722556
1-N,3-N,5-N-tris(2-bicyclo[2.2.1]heptanyl)cyclohexane-1,3,5-tricarboxamide (PubChem CID 171722556) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2-bicyclo[2.2.1]heptanyl)cyclohexane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2-bicyclo[2.2.1]heptanyl)cyclohexane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 171722556 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | 1-N,3-N,5-N-tris(2-bicyclo[2.2.1]heptanyl)cyclohexane-1,3,5-tricarboxamide |
| SMILES | O=C(NC1CC2CCC1C2)C1CC(C(=O)NC2CC3CCC2C3)CC(C(=O)NC2CC3CCC2C3)C1 |
| InChI | InChI=1S/C30H45N3O3/c34-28(31-25-10-16-1-4-19(25)7-16)22-13-23(29(35)32-26-11-17-2-5-20(26)8-17)15-24(14-22)30(36)33-27-12-18-3-6-21(27)9-18/h16-27H,1-15H2,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | HLLJOBDOECHRGG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |