C21H36N2O — CID 46213053
N-[(3aS,4S,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide (PubChem CID 46213053) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is N-[(3aS,4S,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide.
| Compound Name | N-[(3aS,4S,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide |
|---|---|
| PubChem CID | 46213053 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | N-[(3aS,4S,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide |
| SMILES | O=C(N[C@H]1CC[C@H]2CNC[C@H]21)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H36N2O/c24-21(23-19-12-11-17-13-22-14-18(17)19)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h15-20,22H,1-14H2,(H,23,24)/t17-,18+,19-/m0/s1 |
| InChIKey | LCHOSRIKTHYCQA-OTWHNJEPSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |