C17H31N3O — CID 66208739
N-cyclohexyl-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide (PubChem CID 66208739) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide.
| Compound Name | N-cyclohexyl-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide |
|---|---|
| PubChem CID | 66208739 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-cyclohexyl-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide |
| SMILES | CCC1C2CNCC2CN1C(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H31N3O/c1-3-16-15-10-18-9-13(15)11-20(16)12(2)17(21)19-14-7-5-4-6-8-14/h12-16,18H,3-11H2,1-2H3,(H,19,21) |
| InChIKey | ZFTDUABQGVJJNQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |