C17H31N3O — CID 66242551
N-cyclohexyl-2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propanamide (PubChem CID 66242551) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is N-cyclohexyl-2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propanamide.
| Compound Name | N-cyclohexyl-2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propanamide |
|---|---|
| PubChem CID | 66242551 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-cyclohexyl-2-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C17H31N3O/c1-12(16(21)19-14-7-5-4-6-8-14)20-11-13-9-18-10-15(13)17(20,2)3/h12-15,18H,4-11H2,1-3H3,(H,19,21) |
| InChIKey | SMCMQEZQTWFVKD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |