C39H54F2N2O — CID 66590191
N-[(3aS,4R,6aR)-2-[6,6-bis(4-fluorophenyl)hexyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide (PubChem CID 66590191) has the molecular formula C39H54F2N2O and a molecular weight of 604.87 g/mol. Its IUPAC name is N-[(3aS,4R,6aR)-2-[6,6-bis(4-fluorophenyl)hexyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide.
| Compound Name | N-[(3aS,4R,6aR)-2-[6,6-bis(4-fluorophenyl)hexyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide |
|---|---|
| PubChem CID | 66590191 |
| Molecular Formula | C39H54F2N2O |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.42 |
| IUPAC Name | N-[(3aS,4R,6aR)-2-[6,6-bis(4-fluorophenyl)hexyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-dicyclohexylacetamide |
| SMILES | O=C(N[C@@H]1CC[C@H]2CN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C[C@H]21)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C39H54F2N2O/c40-33-20-15-28(16-21-33)35(29-17-22-34(41)23-18-29)14-8-3-9-25-43-26-32-19-24-37(36(32)27-43)42-39(44)38(30-10-4-1-5-11-30)31-12-6-2-7-13-31/h15-18,20-23,30-32,35-38H,1-14,19,24-27H2,(H,42,44)/t32-,36+,37+/m0/s1 |
| InChIKey | BOPBELRGQUQFBO-PCMUHZCQSA-N |
| XLogP | 9.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|