C26H32F2N2O3 — CID 18418754
[1-[4,4-bis(4-fluorophenyl)butylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 18418754) has the molecular formula C26H32F2N2O3 and a molecular weight of 458.55 g/mol. Its IUPAC name is [1-[4,4-bis(4-fluorophenyl)butylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[4,4-bis(4-fluorophenyl)butylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18418754 |
| Molecular Formula | C26H32F2N2O3 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | [1-[4,4-bis(4-fluorophenyl)butylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(CC1CCCCC1)C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H32F2N2O3/c27-21-12-8-19(9-13-21)23(20-10-14-22(28)15-11-20)7-4-16-29-25(31)24(30-26(32)33)17-18-5-2-1-3-6-18/h8-15,18,23-24,30H,1-7,16-17H2,(H,29,31)(H,32,33) |
| InChIKey | TZPZWBPYVQNDAT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|