C24H32F2N2O — CID 18418742
N-[4,4-bis(4-fluorophenyl)butyl]-3-methyl-2-(propan-2-ylamino)butanamide (PubChem CID 18418742) has the molecular formula C24H32F2N2O and a molecular weight of 402.53 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)butyl]-3-methyl-2-(propan-2-ylamino)butanamide.
| Compound Name | N-[4,4-bis(4-fluorophenyl)butyl]-3-methyl-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 18418742 |
| Molecular Formula | C24H32F2N2O |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)butyl]-3-methyl-2-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NC(C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C24H32F2N2O/c1-16(2)23(28-17(3)4)24(29)27-15-5-6-22(18-7-11-20(25)12-8-18)19-9-13-21(26)14-10-19/h7-14,16-17,22-23,28H,5-6,15H2,1-4H3,(H,27,29) |
| InChIKey | XDBCTEDJYDBEEA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|