C24H33ClF2N2O — CID 86758548
(2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-(dimethylamino)-4-methylpentanamide;hydrochloride (PubChem CID 86758548) has the molecular formula C24H33ClF2N2O and a molecular weight of 438.99 g/mol. Its IUPAC name is (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-(dimethylamino)-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-(dimethylamino)-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 86758548 |
| Molecular Formula | C24H33ClF2N2O |
| Molecular Weight | 438.99 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-(dimethylamino)-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@@H](C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C.Cl |
| InChI | InChI=1S/C24H32F2N2O.ClH/c1-17(2)16-23(28(3)4)24(29)27-15-5-6-22(18-7-11-20(25)12-8-18)19-9-13-21(26)14-10-19;/h7-14,17,22-23H,5-6,15-16H2,1-4H3,(H,27,29);1H/t23-;/m0./s1 |
| InChIKey | IQJPLLZRJOOABZ-BQAIUKQQSA-N |
| XLogP | 5.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.99 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|