C28H38F2N4O2 — CID 54304940
N-[(2S)-1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 54304940) has the molecular formula C28H38F2N4O2 and a molecular weight of 500.63 g/mol. Its IUPAC name is N-[(2S)-1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[(2S)-1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 54304940 |
| Molecular Formula | C28H38F2N4O2 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-[(2S)-1-[4,4-bis(4-fluorophenyl)butylamino]-4-methyl-1-oxopentan-2-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)N1CCN(C)CC1)C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H38F2N4O2/c1-20(2)19-26(32-28(36)34-17-15-33(3)16-18-34)27(35)31-14-4-5-25(21-6-10-23(29)11-7-21)22-8-12-24(30)13-9-22/h6-13,20,25-26H,4-5,14-19H2,1-3H3,(H,31,35)(H,32,36)/t26-/m0/s1 |
| InChIKey | SGVGLQGAFNEITD-SANMLTNESA-N |
| XLogP | 4.36 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|