C23H30F2N4O — CID 23371536
4-[2-[bis(4-fluorophenyl)methylamino]ethyl]-N-propan-2-ylpiperazine-1-carboxamide (PubChem CID 23371536) has the molecular formula C23H30F2N4O and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[2-[bis(4-fluorophenyl)methylamino]ethyl]-N-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[bis(4-fluorophenyl)methylamino]ethyl]-N-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 23371536 |
| Molecular Formula | C23H30F2N4O |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 4-[2-[bis(4-fluorophenyl)methylamino]ethyl]-N-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCN(CCNC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30F2N4O/c1-17(2)27-23(30)29-15-13-28(14-16-29)12-11-26-22(18-3-7-20(24)8-4-18)19-5-9-21(25)10-6-19/h3-10,17,22,26H,11-16H2,1-2H3,(H,27,30) |
| InChIKey | QJESHEISCLNNKV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |