C25H32F2N4O — CID 68626796
N-[bis(4-fluorophenyl)methyl]-4-(1-pyrrolidin-1-ylpropyl)piperazine-1-carboxamide (PubChem CID 68626796) has the molecular formula C25H32F2N4O and a molecular weight of 442.55 g/mol. Its IUPAC name is N-[bis(4-fluorophenyl)methyl]-4-(1-pyrrolidin-1-ylpropyl)piperazine-1-carboxamide.
| Compound Name | N-[bis(4-fluorophenyl)methyl]-4-(1-pyrrolidin-1-ylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 68626796 |
| Molecular Formula | C25H32F2N4O |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-[bis(4-fluorophenyl)methyl]-4-(1-pyrrolidin-1-ylpropyl)piperazine-1-carboxamide |
| SMILES | CCC(N1CCCC1)N1CCN(C(=O)NC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H32F2N4O/c1-2-23(29-13-3-4-14-29)30-15-17-31(18-16-30)25(32)28-24(19-5-9-21(26)10-6-19)20-7-11-22(27)12-8-20/h5-12,23-24H,2-4,13-18H2,1H3,(H,28,32) |
| InChIKey | VJOWLXKCCLTMIU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |