C19H22FN3O2 — CID 126424698
N-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]-4-methoxypiperidine-1-carboxamide (PubChem CID 126424698) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]-4-methoxypiperidine-1-carboxamide.
| Compound Name | N-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]-4-methoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 126424698 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-pyridin-4-ylmethyl]-4-methoxypiperidine-1-carboxamide |
| SMILES | COC1CCN(C(=O)N[C@@H](c2ccncc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H22FN3O2/c1-25-17-8-12-23(13-9-17)19(24)22-18(15-6-10-21-11-7-15)14-2-4-16(20)5-3-14/h2-7,10-11,17-18H,8-9,12-13H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | IKOXPSBYXAGBJU-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |